About 7,7-dimethyl-2H-1,4-thiazepine
7,7-dimethyl-2H-1,4-thiazepine (PubChem CID 144615509) has the molecular formula C7H11NS
and a molecular weight of 141.24 g/mol. Its IUPAC name is 7,7-dimethyl-2H-1,4-thiazepine.
Molecular Properties
| Compound Name | 7,7-dimethyl-2H-1,4-thiazepine |
| PubChem CID | 144615509 |
| Molecular Formula | C7H11NS |
| Molecular Weight | 141.24 g/mol |
| Exact Mass | 141.06 |
| IUPAC Name | 7,7-dimethyl-2H-1,4-thiazepine |
| SMILES | CC1(C)C=CN=CCS1 |
| InChI | InChI=1S/C7H11NS/c1-7(2)3-4-8-5-6-9-7/h3-5H,6H2,1-2H3 |
| InChIKey | BDQDRBYHYOORLG-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.24 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7,7-dimethyl-2H-1,4-thiazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,7-dimethyl-2H-1,4-thiazepine?
The IUPAC name of 7,7-dimethyl-2H-1,4-thiazepine (CID 144615509) is 7,7-dimethyl-2H-1,4-thiazepine.
What is the SMILES notation for 7,7-dimethyl-2H-1,4-thiazepine?
The canonical SMILES for 7,7-dimethyl-2H-1,4-thiazepine is CC1(C)C=CN=CCS1.
What is the InChIKey of 7,7-dimethyl-2H-1,4-thiazepine?
The InChIKey is BDQDRBYHYOORLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NS/c1-7(2)3-4-8-5-6-9-7/h3-5H,6H2,1-2H3.
What are the key properties of 7,7-dimethyl-2H-1,4-thiazepine?
7,7-dimethyl-2H-1,4-thiazepine has a molecular weight of 141.24 g/mol, XLogP of 2.10, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7,7-dimethyl-2H-1,4-thiazepine is sourced from PubChem (CID 144615509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).