C23H28N4O — CID 144615523
3-[5-(2,3-dihydro-1H-inden-2-yl)-4-ethyl-1,2,4-triazol-3-yl]propanal;N-methylaniline (PubChem CID 144615523) has the molecular formula C23H28N4O and a molecular weight of 376.50 g/mol. Its IUPAC name is 3-[5-(2,3-dihydro-1H-inden-2-yl)-4-ethyl-1,2,4-triazol-3-yl]propanal;N-methylaniline.
| Compound Name | 3-[5-(2,3-dihydro-1H-inden-2-yl)-4-ethyl-1,2,4-triazol-3-yl]propanal;N-methylaniline |
|---|---|
| PubChem CID | 144615523 |
| Molecular Formula | C23H28N4O |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.23 |
| IUPAC Name | 3-[5-(2,3-dihydro-1H-inden-2-yl)-4-ethyl-1,2,4-triazol-3-yl]propanal;N-methylaniline |
| SMILES | CCn1c(CCC=O)nnc1C1Cc2ccccc2C1.CNc1ccccc1 |
| InChI | InChI=1S/C16H19N3O.C7H9N/c1-2-19-15(8-5-9-20)17-18-16(19)14-10-12-6-3-4-7-13(12)11-14;1-8-7-5-3-2-4-6-7/h3-4,6-7,9,14H,2,5,8,10-11H2,1H3;2-6,8H,1H3 |
| InChIKey | LDEKTXPIYPNNTA-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|