C22H33N — CID 144615797
2-[6-(2,3-dimethylhept-4-en-3-yl)cyclohexa-1,3-dien-1-yl]pyridine;ethane (PubChem CID 144615797) has the molecular formula C22H33N and a molecular weight of 311.51 g/mol. Its IUPAC name is 2-[6-(2,3-dimethylhept-4-en-3-yl)cyclohexa-1,3-dien-1-yl]pyridine;ethane.
| Compound Name | 2-[6-(2,3-dimethylhept-4-en-3-yl)cyclohexa-1,3-dien-1-yl]pyridine;ethane |
|---|---|
| PubChem CID | 144615797 |
| Molecular Formula | C22H33N |
| Molecular Weight | 311.51 g/mol |
| Exact Mass | 311.26 |
| IUPAC Name | 2-[6-(2,3-dimethylhept-4-en-3-yl)cyclohexa-1,3-dien-1-yl]pyridine;ethane |
| SMILES | CC.CCC=CC(C)(C(C)C)C1CC=CC=C1c1ccccn1 |
| InChI | InChI=1S/C20H27N.C2H6/c1-5-6-14-20(4,16(2)3)18-12-8-7-11-17(18)19-13-9-10-15-21-19;1-2/h6-11,13-16,18H,5,12H2,1-4H3;1-2H3 |
| InChIKey | BCPONMSDRVJOAO-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.51 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|