C14H21N3O — CID 144616313
ethane;3-methyl-2-piperidin-3-yloxypyridine-4-carbonitrile (PubChem CID 144616313) has the molecular formula C14H21N3O and a molecular weight of 247.34 g/mol. Its IUPAC name is ethane;3-methyl-2-piperidin-3-yloxypyridine-4-carbonitrile.
| Compound Name | ethane;3-methyl-2-piperidin-3-yloxypyridine-4-carbonitrile |
|---|---|
| PubChem CID | 144616313 |
| Molecular Formula | C14H21N3O |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.17 |
| IUPAC Name | ethane;3-methyl-2-piperidin-3-yloxypyridine-4-carbonitrile |
| SMILES | CC.Cc1c(C#N)ccnc1OC1CCCNC1 |
| InChI | InChI=1S/C12H15N3O.C2H6/c1-9-10(7-13)4-6-15-12(9)16-11-3-2-5-14-8-11;1-2/h4,6,11,14H,2-3,5,8H2,1H3;1-2H3 |
| InChIKey | WVHPFYOKVDHUDB-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |