C17H15F2N3O4 — CID 144616515
(7S)-6-(2,2-difluoro-1,3-benzodioxol-5-yl)-2,7-dimethyl-1,4-dioxo-3,6,8,8a-tetrahydropyrrolo[1,2-a]pyrazine-7-carbonitrile (PubChem CID 144616515) has the molecular formula C17H15F2N3O4 and a molecular weight of 363.32 g/mol. Its IUPAC name is (7S)-6-(2,2-difluoro-1,3-benzodioxol-5-yl)-2,7-dimethyl-1,4-dioxo-3,6,8,8a-tetrahydropyrrolo[1,2-a]pyrazine-7-carbonitrile.
| Compound Name | (7S)-6-(2,2-difluoro-1,3-benzodioxol-5-yl)-2,7-dimethyl-1,4-dioxo-3,6,8,8a-tetrahydropyrrolo[1,2-a]pyrazine-7-carbonitrile |
|---|---|
| PubChem CID | 144616515 |
| Molecular Formula | C17H15F2N3O4 |
| Molecular Weight | 363.32 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | (7S)-6-(2,2-difluoro-1,3-benzodioxol-5-yl)-2,7-dimethyl-1,4-dioxo-3,6,8,8a-tetrahydropyrrolo[1,2-a]pyrazine-7-carbonitrile |
| SMILES | CN1CC(=O)N2C(C[C@](C)(C#N)C2c2ccc3c(c2)OC(F)(F)O3)C1=O |
| InChI | InChI=1S/C17H15F2N3O4/c1-16(8-20)6-10-15(24)21(2)7-13(23)22(10)14(16)9-3-4-11-12(5-9)26-17(18,19)25-11/h3-5,10,14H,6-7H2,1-2H3/t10?,14?,16-/m1/s1 |
| InChIKey | JGKUABHLICYYJG-DARSQCIJSA-N |
| XLogP | 1.65 |
| TPSA | 82.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.32 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |