C22H27NO3 — CID 144616946
ethane;1-methoxy-4-methylbenzene;1-[(4-methylphenyl)methyl]pyrrole-2,5-dione (PubChem CID 144616946) has the molecular formula C22H27NO3 and a molecular weight of 353.46 g/mol. Its IUPAC name is ethane;1-methoxy-4-methylbenzene;1-[(4-methylphenyl)methyl]pyrrole-2,5-dione.
| Compound Name | ethane;1-methoxy-4-methylbenzene;1-[(4-methylphenyl)methyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 144616946 |
| Molecular Formula | C22H27NO3 |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | ethane;1-methoxy-4-methylbenzene;1-[(4-methylphenyl)methyl]pyrrole-2,5-dione |
| SMILES | CC.COc1ccc(C)cc1.Cc1ccc(CN2C(=O)C=CC2=O)cc1 |
| InChI | InChI=1S/C12H11NO2.C8H10O.C2H6/c1-9-2-4-10(5-3-9)8-13-11(14)6-7-12(13)15;1-7-3-5-8(9-2)6-4-7;1-2/h2-7H,8H2,1H3;3-6H,1-2H3;1-2H3 |
| InChIKey | ZQGAXHVSMCVUSX-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|