About 4-chloro-3,5-diphenyl-1-propylpyrazolo[3,4-c]pyridazine;ethane
4-chloro-3,5-diphenyl-1-propylpyrazolo[3,4-c]pyridazine;ethane (PubChem CID 144617112) has the molecular formula C22H23ClN4
and a molecular weight of 378.91 g/mol. Its IUPAC name is 4-chloro-3,5-diphenyl-1-propylpyrazolo[3,4-c]pyridazine;ethane.
Molecular Properties
| Compound Name | 4-chloro-3,5-diphenyl-1-propylpyrazolo[3,4-c]pyridazine;ethane |
| PubChem CID | 144617112 |
| Molecular Formula | C22H23ClN4 |
| Molecular Weight | 378.91 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | 4-chloro-3,5-diphenyl-1-propylpyrazolo[3,4-c]pyridazine;ethane |
| SMILES | CC.CCCn1nc(-c2ccccc2)c2c(Cl)c(-c3ccccc3)nnc21 |
| InChI | InChI=1S/C20H17ClN4.C2H6/c1-2-13-25-20-16(18(24-25)14-9-5-3-6-10-14)17(21)19(22-23-20)15-11-7-4-8-12-15;1-2/h3-12H,2,13H2,1H3;1-2H3 |
| InChIKey | DVBKDQDPXJUDLX-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 378.91 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-chloro-3,5-diphenyl-1-propylpyrazolo[3,4-c]pyridazine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-3,5-diphenyl-1-propylpyrazolo[3,4-c]pyridazine;ethane?
The IUPAC name of 4-chloro-3,5-diphenyl-1-propylpyrazolo[3,4-c]pyridazine;ethane (CID 144617112) is 4-chloro-3,5-diphenyl-1-propylpyrazolo[3,4-c]pyridazine;ethane.
What is the SMILES notation for 4-chloro-3,5-diphenyl-1-propylpyrazolo[3,4-c]pyridazine;ethane?
The canonical SMILES for 4-chloro-3,5-diphenyl-1-propylpyrazolo[3,4-c]pyridazine;ethane is CC.CCCn1nc(-c2ccccc2)c2c(Cl)c(-c3ccccc3)nnc21.
What is the InChIKey of 4-chloro-3,5-diphenyl-1-propylpyrazolo[3,4-c]pyridazine;ethane?
The InChIKey is DVBKDQDPXJUDLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17ClN4.C2H6/c1-2-13-25-20-16(18(24-25)14-9-5-3-6-10-14)17(21)19(22-23-20)15-11-7-4-8-12-15;1-2/h3-12H,2,13H2,1H3;1-2H3.
What are the key properties of 4-chloro-3,5-diphenyl-1-propylpyrazolo[3,4-c]pyridazine;ethane?
4-chloro-3,5-diphenyl-1-propylpyrazolo[3,4-c]pyridazine;ethane has a molecular weight of 378.91 g/mol, XLogP of 6.25, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-3,5-diphenyl-1-propylpyrazolo[3,4-c]pyridazine;ethane is sourced from PubChem (CID 144617112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).