About N-(4,5-dimethyl-1H-pyrazol-3-yl)acetamide;ethane
N-(4,5-dimethyl-1H-pyrazol-3-yl)acetamide;ethane (PubChem CID 144617181) has the molecular formula C9H17N3O
and a molecular weight of 183.25 g/mol. Its IUPAC name is N-(4,5-dimethyl-1H-pyrazol-3-yl)acetamide;ethane.
Molecular Properties
| Compound Name | N-(4,5-dimethyl-1H-pyrazol-3-yl)acetamide;ethane |
| PubChem CID | 144617181 |
| Molecular Formula | C9H17N3O |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.14 |
| IUPAC Name | N-(4,5-dimethyl-1H-pyrazol-3-yl)acetamide;ethane |
| SMILES | CC.CC(=O)Nc1n[nH]c(C)c1C |
| InChI | InChI=1S/C7H11N3O.C2H6/c1-4-5(2)9-10-7(4)8-6(3)11;1-2/h1-3H3,(H2,8,9,10,11);1-2H3 |
| InChIKey | CZKZITMNIBMYIP-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(4,5-dimethyl-1H-pyrazol-3-yl)acetamide;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4,5-dimethyl-1H-pyrazol-3-yl)acetamide;ethane?
The IUPAC name of N-(4,5-dimethyl-1H-pyrazol-3-yl)acetamide;ethane (CID 144617181) is N-(4,5-dimethyl-1H-pyrazol-3-yl)acetamide;ethane.
What is the SMILES notation for N-(4,5-dimethyl-1H-pyrazol-3-yl)acetamide;ethane?
The canonical SMILES for N-(4,5-dimethyl-1H-pyrazol-3-yl)acetamide;ethane is CC.CC(=O)Nc1n[nH]c(C)c1C.
What is the InChIKey of N-(4,5-dimethyl-1H-pyrazol-3-yl)acetamide;ethane?
The InChIKey is CZKZITMNIBMYIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N3O.C2H6/c1-4-5(2)9-10-7(4)8-6(3)11;1-2/h1-3H3,(H2,8,9,10,11);1-2H3.
What are the key properties of N-(4,5-dimethyl-1H-pyrazol-3-yl)acetamide;ethane?
N-(4,5-dimethyl-1H-pyrazol-3-yl)acetamide;ethane has a molecular weight of 183.25 g/mol, XLogP of 2.01, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4,5-dimethyl-1H-pyrazol-3-yl)acetamide;ethane is sourced from PubChem (CID 144617181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).