C21H23N3O — CID 144617182
2-[5-amino-3-phenyl-4-(2-phenylethynyl)pyrazol-1-yl]ethanol;ethane (PubChem CID 144617182) has the molecular formula C21H23N3O and a molecular weight of 333.44 g/mol. Its IUPAC name is 2-[5-amino-3-phenyl-4-(2-phenylethynyl)pyrazol-1-yl]ethanol;ethane.
| Compound Name | 2-[5-amino-3-phenyl-4-(2-phenylethynyl)pyrazol-1-yl]ethanol;ethane |
|---|---|
| PubChem CID | 144617182 |
| Molecular Formula | C21H23N3O |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.18 |
| IUPAC Name | 2-[5-amino-3-phenyl-4-(2-phenylethynyl)pyrazol-1-yl]ethanol;ethane |
| SMILES | CC.Nc1c(C#Cc2ccccc2)c(-c2ccccc2)nn1CCO |
| InChI | InChI=1S/C19H17N3O.C2H6/c20-19-17(12-11-15-7-3-1-4-8-15)18(21-22(19)13-14-23)16-9-5-2-6-10-16;1-2/h1-10,23H,13-14,20H2;1-2H3 |
| InChIKey | GHENVGFCLPCHIL-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|