C9H16N2O2S — CID 144617201
(3aS,5R,6S,7aR)-5-ethyl-2-methylimino-1,3a,5,6,7,7a-hexahydrothiopyrano[3,2-d][1,3]oxazol-6-ol (PubChem CID 144617201) has the molecular formula C9H16N2O2S and a molecular weight of 216.31 g/mol. Its IUPAC name is (3aS,5R,6S,7aR)-5-ethyl-2-methylimino-1,3a,5,6,7,7a-hexahydrothiopyrano[3,2-d][1,3]oxazol-6-ol.
| Compound Name | (3aS,5R,6S,7aR)-5-ethyl-2-methylimino-1,3a,5,6,7,7a-hexahydrothiopyrano[3,2-d][1,3]oxazol-6-ol |
|---|---|
| PubChem CID | 144617201 |
| Molecular Formula | C9H16N2O2S |
| Molecular Weight | 216.31 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | (3aS,5R,6S,7aR)-5-ethyl-2-methylimino-1,3a,5,6,7,7a-hexahydrothiopyrano[3,2-d][1,3]oxazol-6-ol |
| SMILES | CC[C@H]1S[C@@H]2O/C(=N\C)N[C@@H]2C[C@@H]1O |
| InChI | InChI=1S/C9H16N2O2S/c1-3-7-6(12)4-5-8(14-7)13-9(10-2)11-5/h5-8,12H,3-4H2,1-2H3,(H,10,11)/t5-,6+,7-,8+/m1/s1 |
| InChIKey | ONNFYXKGSDGLAY-CWKFCGSDSA-N |
| XLogP | 0.56 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.31 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|