About (5-methoxyoxolan-2-yl)methyl trifluoromethanesulfonate;propane-2,2-diol
(5-methoxyoxolan-2-yl)methyl trifluoromethanesulfonate;propane-2,2-diol (PubChem CID 144617421) has the molecular formula C10H19F3O7S
and a molecular weight of 340.32 g/mol. Its IUPAC name is (5-methoxyoxolan-2-yl)methyl trifluoromethanesulfonate;propane-2,2-diol.
Molecular Properties
| Compound Name | (5-methoxyoxolan-2-yl)methyl trifluoromethanesulfonate;propane-2,2-diol |
| PubChem CID | 144617421 |
| Molecular Formula | C10H19F3O7S |
| Molecular Weight | 340.32 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | (5-methoxyoxolan-2-yl)methyl trifluoromethanesulfonate;propane-2,2-diol |
| SMILES | CC(C)(O)O.COC1CCC(COS(=O)(=O)C(F)(F)F)O1 |
| InChI | InChI=1S/C7H11F3O5S.C3H8O2/c1-13-6-3-2-5(15-6)4-14-16(11,12)7(8,9)10;1-3(2,4)5/h5-6H,2-4H2,1H3;4-5H,1-2H3 |
| InChIKey | ORTSPLRADSBHBT-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.32 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze (5-methoxyoxolan-2-yl)methyl trifluoromethanesulfonate;propane-2,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-methoxyoxolan-2-yl)methyl trifluoromethanesulfonate;propane-2,2-diol?
The IUPAC name of (5-methoxyoxolan-2-yl)methyl trifluoromethanesulfonate;propane-2,2-diol (CID 144617421) is (5-methoxyoxolan-2-yl)methyl trifluoromethanesulfonate;propane-2,2-diol.
What is the SMILES notation for (5-methoxyoxolan-2-yl)methyl trifluoromethanesulfonate;propane-2,2-diol?
The canonical SMILES for (5-methoxyoxolan-2-yl)methyl trifluoromethanesulfonate;propane-2,2-diol is CC(C)(O)O.COC1CCC(COS(=O)(=O)C(F)(F)F)O1.
What is the InChIKey of (5-methoxyoxolan-2-yl)methyl trifluoromethanesulfonate;propane-2,2-diol?
The InChIKey is ORTSPLRADSBHBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11F3O5S.C3H8O2/c1-13-6-3-2-5(15-6)4-14-16(11,12)7(8,9)10;1-3(2,4)5/h5-6H,2-4H2,1H3;4-5H,1-2H3.
What are the key properties of (5-methoxyoxolan-2-yl)methyl trifluoromethanesulfonate;propane-2,2-diol?
(5-methoxyoxolan-2-yl)methyl trifluoromethanesulfonate;propane-2,2-diol has a molecular weight of 340.32 g/mol, XLogP of 0.71, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (5-methoxyoxolan-2-yl)methyl trifluoromethanesulfonate;propane-2,2-diol is sourced from PubChem (CID 144617421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).