C33H42BrN3O7 — CID 144617463
(8-bromo-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-19-yl) 3,3-dimethyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate;ethane (PubChem CID 144617463) has the molecular formula C33H42BrN3O7 and a molecular weight of 672.62 g/mol. Its IUPAC name is (8-bromo-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-19-yl) 3,3-dimethyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate;ethane.
| Compound Name | (8-bromo-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-19-yl) 3,3-dimethyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate;ethane |
|---|---|
| PubChem CID | 144617463 |
| Molecular Formula | C33H42BrN3O7 |
| Molecular Weight | 672.62 g/mol |
| Exact Mass | 671.22 |
| IUPAC Name | (8-bromo-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-19-yl) 3,3-dimethyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate;ethane |
| SMILES | CC.CC.CC(C)(CNC(=O)OC(C)(C)C)CC(=O)OC1C(=O)OCc2c1cc1n(c2=O)Cc2cc3c(Br)cccc3nc2-1 |
| InChI | InChI=1S/C29H30BrN3O7.2C2H6/c1-28(2,3)40-27(37)31-14-29(4,5)11-22(34)39-24-16-10-21-23-15(9-17-19(30)7-6-8-20(17)32-23)12-33(21)25(35)18(16)13-38-26(24)36;2*1-2/h6-10,24H,11-14H2,1-5H3,(H,31,37);2*1-2H3 |
| InChIKey | WDZPNQAVSTXMNI-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 125.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.62 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|