C5H3N3S3 — CID 144617469
5-(1,3-thiazol-5-yl)-3H-1,3,4-thiadiazole-2-thione (PubChem CID 144617469) has the molecular formula C5H3N3S3 and a molecular weight of 201.30 g/mol. Its IUPAC name is 5-(1,3-thiazol-5-yl)-3H-1,3,4-thiadiazole-2-thione.
| Compound Name | 5-(1,3-thiazol-5-yl)-3H-1,3,4-thiadiazole-2-thione |
|---|---|
| PubChem CID | 144617469 |
| Molecular Formula | C5H3N3S3 |
| Molecular Weight | 201.30 g/mol |
| Exact Mass | 200.95 |
| IUPAC Name | 5-(1,3-thiazol-5-yl)-3H-1,3,4-thiadiazole-2-thione |
| SMILES | S=c1[nH]nc(-c2cncs2)s1 |
| InChI | InChI=1S/C5H3N3S3/c9-5-8-7-4(11-5)3-1-6-2-10-3/h1-2H,(H,8,9) |
| InChIKey | KHOUCGXUXNPWPQ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.30 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|