About (1Z)-1-(2,5-dichloro-3,4-dihydroxyphenyl)-1-hydroxyimino-3-methylbutan-2-one
(1Z)-1-(2,5-dichloro-3,4-dihydroxyphenyl)-1-hydroxyimino-3-methylbutan-2-one (PubChem CID 144617801) has the molecular formula C11H11Cl2NO4
and a molecular weight of 292.12 g/mol. Its IUPAC name is (1Z)-1-(2,5-dichloro-3,4-dihydroxyphenyl)-1-hydroxyimino-3-methylbutan-2-one.
Molecular Properties
| Compound Name | (1Z)-1-(2,5-dichloro-3,4-dihydroxyphenyl)-1-hydroxyimino-3-methylbutan-2-one |
| PubChem CID | 144617801 |
| Molecular Formula | C11H11Cl2NO4 |
| Molecular Weight | 292.12 g/mol |
| Exact Mass | 291.01 |
| IUPAC Name | (1Z)-1-(2,5-dichloro-3,4-dihydroxyphenyl)-1-hydroxyimino-3-methylbutan-2-one |
| SMILES | CC(C)C(=O)/C(=N\O)c1cc(Cl)c(O)c(O)c1Cl |
| InChI | InChI=1S/C11H11Cl2NO4/c1-4(2)9(15)8(14-18)5-3-6(12)10(16)11(17)7(5)13/h3-4,16-18H,1-2H3/b14-8- |
| InChIKey | OIEKAZJXBCXCRJ-ZSOIEALJSA-N |
| XLogP | 2.81 |
| TPSA | 90.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.12 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'} |
|---|
Analyze (1Z)-1-(2,5-dichloro-3,4-dihydroxyphenyl)-1-hydroxyimino-3-methylbutan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1Z)-1-(2,5-dichloro-3,4-dihydroxyphenyl)-1-hydroxyimino-3-methylbutan-2-one?
The IUPAC name of (1Z)-1-(2,5-dichloro-3,4-dihydroxyphenyl)-1-hydroxyimino-3-methylbutan-2-one (CID 144617801) is (1Z)-1-(2,5-dichloro-3,4-dihydroxyphenyl)-1-hydroxyimino-3-methylbutan-2-one.
What is the SMILES notation for (1Z)-1-(2,5-dichloro-3,4-dihydroxyphenyl)-1-hydroxyimino-3-methylbutan-2-one?
The canonical SMILES for (1Z)-1-(2,5-dichloro-3,4-dihydroxyphenyl)-1-hydroxyimino-3-methylbutan-2-one is CC(C)C(=O)/C(=N\O)c1cc(Cl)c(O)c(O)c1Cl.
What is the InChIKey of (1Z)-1-(2,5-dichloro-3,4-dihydroxyphenyl)-1-hydroxyimino-3-methylbutan-2-one?
The InChIKey is OIEKAZJXBCXCRJ-ZSOIEALJSA-N. The full InChI is InChI=1S/C11H11Cl2NO4/c1-4(2)9(15)8(14-18)5-3-6(12)10(16)11(17)7(5)13/h3-4,16-18H,1-2H3/b14-8-.
What are the key properties of (1Z)-1-(2,5-dichloro-3,4-dihydroxyphenyl)-1-hydroxyimino-3-methylbutan-2-one?
(1Z)-1-(2,5-dichloro-3,4-dihydroxyphenyl)-1-hydroxyimino-3-methylbutan-2-one has a molecular weight of 292.12 g/mol, XLogP of 2.81, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1Z)-1-(2,5-dichloro-3,4-dihydroxyphenyl)-1-hydroxyimino-3-methylbutan-2-one is sourced from PubChem (CID 144617801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).