About ethane;methyl-[(2E)-3-methylsulfanylpenta-2,4-dienylidene]azanium
ethane;methyl-[(2E)-3-methylsulfanylpenta-2,4-dienylidene]azanium (PubChem CID 144617883) has the molecular formula C9H18NS+
and a molecular weight of 172.32 g/mol. Its IUPAC name is ethane;methyl-[(2E)-3-methylsulfanylpenta-2,4-dienylidene]azanium.
Molecular Properties
| Compound Name | ethane;methyl-[(2E)-3-methylsulfanylpenta-2,4-dienylidene]azanium |
| PubChem CID | 144617883 |
| Molecular Formula | C9H18NS+ |
| Molecular Weight | 172.32 g/mol |
| Exact Mass | 172.12 |
| IUPAC Name | ethane;methyl-[(2E)-3-methylsulfanylpenta-2,4-dienylidene]azanium |
| SMILES | C=C/C(=C\C=[NH+]\C)SC.CC |
| InChI | InChI=1S/C7H11NS.C2H6/c1-4-7(9-3)5-6-8-2;1-2/h4-6H,1H2,2-3H3;1-2H3/p+1/b7-5+,8-6+; |
| InChIKey | WVFNKRBIIHRDBO-PUFOULASSA-O |
| XLogP | 1.23 |
| TPSA | 13.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.32 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;methyl-[(2E)-3-methylsulfanylpenta-2,4-dienylidene]azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methyl-[(2E)-3-methylsulfanylpenta-2,4-dienylidene]azanium?
The IUPAC name of ethane;methyl-[(2E)-3-methylsulfanylpenta-2,4-dienylidene]azanium (CID 144617883) is ethane;methyl-[(2E)-3-methylsulfanylpenta-2,4-dienylidene]azanium.
What is the SMILES notation for ethane;methyl-[(2E)-3-methylsulfanylpenta-2,4-dienylidene]azanium?
The canonical SMILES for ethane;methyl-[(2E)-3-methylsulfanylpenta-2,4-dienylidene]azanium is C=C/C(=C\C=[NH+]\C)SC.CC.
What is the InChIKey of ethane;methyl-[(2E)-3-methylsulfanylpenta-2,4-dienylidene]azanium?
The InChIKey is WVFNKRBIIHRDBO-PUFOULASSA-O. The full InChI is InChI=1S/C7H11NS.C2H6/c1-4-7(9-3)5-6-8-2;1-2/h4-6H,1H2,2-3H3;1-2H3/p+1/b7-5+,8-6+;.
What are the key properties of ethane;methyl-[(2E)-3-methylsulfanylpenta-2,4-dienylidene]azanium?
ethane;methyl-[(2E)-3-methylsulfanylpenta-2,4-dienylidene]azanium has a molecular weight of 172.32 g/mol, XLogP of 1.23, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methyl-[(2E)-3-methylsulfanylpenta-2,4-dienylidene]azanium is sourced from PubChem (CID 144617883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).