About 1-tert-butyl-6,7-dihydroxy-3-methylquinolin-4-one;ethane
1-tert-butyl-6,7-dihydroxy-3-methylquinolin-4-one;ethane (PubChem CID 144618129) has the molecular formula C16H23NO3
and a molecular weight of 277.36 g/mol. Its IUPAC name is 1-tert-butyl-6,7-dihydroxy-3-methylquinolin-4-one;ethane.
Molecular Properties
| Compound Name | 1-tert-butyl-6,7-dihydroxy-3-methylquinolin-4-one;ethane |
| PubChem CID | 144618129 |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | 1-tert-butyl-6,7-dihydroxy-3-methylquinolin-4-one;ethane |
| SMILES | CC.Cc1cn(C(C)(C)C)c2cc(O)c(O)cc2c1=O |
| InChI | InChI=1S/C14H17NO3.C2H6/c1-8-7-15(14(2,3)4)10-6-12(17)11(16)5-9(10)13(8)18;1-2/h5-7,16-17H,1-4H3;1-2H3 |
| InChIKey | RDAJORPEJYFYBQ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 1-tert-butyl-6,7-dihydroxy-3-methylquinolin-4-one;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-6,7-dihydroxy-3-methylquinolin-4-one;ethane?
The IUPAC name of 1-tert-butyl-6,7-dihydroxy-3-methylquinolin-4-one;ethane (CID 144618129) is 1-tert-butyl-6,7-dihydroxy-3-methylquinolin-4-one;ethane.
What is the SMILES notation for 1-tert-butyl-6,7-dihydroxy-3-methylquinolin-4-one;ethane?
The canonical SMILES for 1-tert-butyl-6,7-dihydroxy-3-methylquinolin-4-one;ethane is CC.Cc1cn(C(C)(C)C)c2cc(O)c(O)cc2c1=O.
What is the InChIKey of 1-tert-butyl-6,7-dihydroxy-3-methylquinolin-4-one;ethane?
The InChIKey is RDAJORPEJYFYBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17NO3.C2H6/c1-8-7-15(14(2,3)4)10-6-12(17)11(16)5-9(10)13(8)18;1-2/h5-7,16-17H,1-4H3;1-2H3.
What are the key properties of 1-tert-butyl-6,7-dihydroxy-3-methylquinolin-4-one;ethane?
1-tert-butyl-6,7-dihydroxy-3-methylquinolin-4-one;ethane has a molecular weight of 277.36 g/mol, XLogP of 3.50, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-6,7-dihydroxy-3-methylquinolin-4-one;ethane is sourced from PubChem (CID 144618129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).