About 2-aminoisoquinolin-2-ium-7,8-diol
2-aminoisoquinolin-2-ium-7,8-diol (PubChem CID 144618148) has the molecular formula C9H9N2O2+
and a molecular weight of 177.18 g/mol. Its IUPAC name is 2-aminoisoquinolin-2-ium-7,8-diol.
Molecular Properties
| Compound Name | 2-aminoisoquinolin-2-ium-7,8-diol |
| PubChem CID | 144618148 |
| Molecular Formula | C9H9N2O2+ |
| Molecular Weight | 177.18 g/mol |
| Exact Mass | 177.07 |
| IUPAC Name | 2-aminoisoquinolin-2-ium-7,8-diol |
| SMILES | N[n+]1ccc2ccc(O)c(O)c2c1 |
| InChI | InChI=1S/C9H8N2O2/c10-11-4-3-6-1-2-8(12)9(13)7(6)5-11/h1-5,12H,10H2/p+1 |
| InChIKey | KZGSLHSGTUVVAB-UHFFFAOYSA-O |
| XLogP | 0.25 |
| TPSA | 70.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.18 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-aminoisoquinolin-2-ium-7,8-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminoisoquinolin-2-ium-7,8-diol?
The IUPAC name of 2-aminoisoquinolin-2-ium-7,8-diol (CID 144618148) is 2-aminoisoquinolin-2-ium-7,8-diol.
What is the SMILES notation for 2-aminoisoquinolin-2-ium-7,8-diol?
The canonical SMILES for 2-aminoisoquinolin-2-ium-7,8-diol is N[n+]1ccc2ccc(O)c(O)c2c1.
What is the InChIKey of 2-aminoisoquinolin-2-ium-7,8-diol?
The InChIKey is KZGSLHSGTUVVAB-UHFFFAOYSA-O. The full InChI is InChI=1S/C9H8N2O2/c10-11-4-3-6-1-2-8(12)9(13)7(6)5-11/h1-5,12H,10H2/p+1.
What are the key properties of 2-aminoisoquinolin-2-ium-7,8-diol?
2-aminoisoquinolin-2-ium-7,8-diol has a molecular weight of 177.18 g/mol, XLogP of 0.25, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoisoquinolin-2-ium-7,8-diol is sourced from PubChem (CID 144618148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).