C10H6F8O — CID 144618300
1-ethyl-2,3,4,5,6-pentafluorobenzene;2,2,2-trifluoroacetaldehyde (PubChem CID 144618300) has the molecular formula C10H6F8O and a molecular weight of 294.14 g/mol. Its IUPAC name is 1-ethyl-2,3,4,5,6-pentafluorobenzene;2,2,2-trifluoroacetaldehyde.
| Compound Name | 1-ethyl-2,3,4,5,6-pentafluorobenzene;2,2,2-trifluoroacetaldehyde |
|---|---|
| PubChem CID | 144618300 |
| Molecular Formula | C10H6F8O |
| Molecular Weight | 294.14 g/mol |
| Exact Mass | 294.03 |
| IUPAC Name | 1-ethyl-2,3,4,5,6-pentafluorobenzene;2,2,2-trifluoroacetaldehyde |
| SMILES | CCc1c(F)c(F)c(F)c(F)c1F.O=CC(F)(F)F |
| InChI | InChI=1S/C8H5F5.C2HF3O/c1-2-3-4(9)6(11)8(13)7(12)5(3)10;3-2(4,5)1-6/h2H2,1H3;1H |
| InChIKey | QOYMZDSXUSJHLC-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.14 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|