About ethane;S-[4-(5-oxo-4-phenyl-2H-furan-3-yl)phenyl] ethanethioate
ethane;S-[4-(5-oxo-4-phenyl-2H-furan-3-yl)phenyl] ethanethioate (PubChem CID 144618521) has the molecular formula C20H20O3S
and a molecular weight of 340.44 g/mol. Its IUPAC name is ethane;S-[4-(5-oxo-4-phenyl-2H-furan-3-yl)phenyl] ethanethioate.
Molecular Properties
| Compound Name | ethane;S-[4-(5-oxo-4-phenyl-2H-furan-3-yl)phenyl] ethanethioate |
| PubChem CID | 144618521 |
| Molecular Formula | C20H20O3S |
| Molecular Weight | 340.44 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | ethane;S-[4-(5-oxo-4-phenyl-2H-furan-3-yl)phenyl] ethanethioate |
| SMILES | CC.CC(=O)Sc1ccc(C2=C(c3ccccc3)C(=O)OC2)cc1 |
| InChI | InChI=1S/C18H14O3S.C2H6/c1-12(19)22-15-9-7-13(8-10-15)16-11-21-18(20)17(16)14-5-3-2-4-6-14;1-2/h2-10H,11H2,1H3;1-2H3 |
| InChIKey | BCJOZSSEDIMADQ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.44 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze ethane;S-[4-(5-oxo-4-phenyl-2H-furan-3-yl)phenyl] ethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;S-[4-(5-oxo-4-phenyl-2H-furan-3-yl)phenyl] ethanethioate?
The IUPAC name of ethane;S-[4-(5-oxo-4-phenyl-2H-furan-3-yl)phenyl] ethanethioate (CID 144618521) is ethane;S-[4-(5-oxo-4-phenyl-2H-furan-3-yl)phenyl] ethanethioate.
What is the SMILES notation for ethane;S-[4-(5-oxo-4-phenyl-2H-furan-3-yl)phenyl] ethanethioate?
The canonical SMILES for ethane;S-[4-(5-oxo-4-phenyl-2H-furan-3-yl)phenyl] ethanethioate is CC.CC(=O)Sc1ccc(C2=C(c3ccccc3)C(=O)OC2)cc1.
What is the InChIKey of ethane;S-[4-(5-oxo-4-phenyl-2H-furan-3-yl)phenyl] ethanethioate?
The InChIKey is BCJOZSSEDIMADQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14O3S.C2H6/c1-12(19)22-15-9-7-13(8-10-15)16-11-21-18(20)17(16)14-5-3-2-4-6-14;1-2/h2-10H,11H2,1H3;1-2H3.
What are the key properties of ethane;S-[4-(5-oxo-4-phenyl-2H-furan-3-yl)phenyl] ethanethioate?
ethane;S-[4-(5-oxo-4-phenyl-2H-furan-3-yl)phenyl] ethanethioate has a molecular weight of 340.44 g/mol, XLogP of 4.82, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;S-[4-(5-oxo-4-phenyl-2H-furan-3-yl)phenyl] ethanethioate is sourced from PubChem (CID 144618521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).