C7H14N4S — CID 144618570
ethane;4,5,6,7-tetrahydro-1H-purine-6-thiol (PubChem CID 144618570) has the molecular formula C7H14N4S and a molecular weight of 186.28 g/mol. Its IUPAC name is ethane;4,5,6,7-tetrahydro-1H-purine-6-thiol.
| Compound Name | ethane;4,5,6,7-tetrahydro-1H-purine-6-thiol |
|---|---|
| PubChem CID | 144618570 |
| Molecular Formula | C7H14N4S |
| Molecular Weight | 186.28 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | ethane;4,5,6,7-tetrahydro-1H-purine-6-thiol |
| SMILES | CC.SC1NC=NC2N=CNC21 |
| InChI | InChI=1S/C5H8N4S.C2H6/c10-5-3-4(7-1-6-3)8-2-9-5;1-2/h1-5,10H,(H,6,7)(H,8,9);1-2H3 |
| InChIKey | WBRXVIBGYJKKIW-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.28 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|