About 6-nitro-3H-1,3-benzothiazol-2-one;propane
6-nitro-3H-1,3-benzothiazol-2-one;propane (PubChem CID 144618967) has the molecular formula C10H12N2O3S
and a molecular weight of 240.28 g/mol. Its IUPAC name is 6-nitro-3H-1,3-benzothiazol-2-one;propane.
Molecular Properties
| Compound Name | 6-nitro-3H-1,3-benzothiazol-2-one;propane |
| PubChem CID | 144618967 |
| Molecular Formula | C10H12N2O3S |
| Molecular Weight | 240.28 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | 6-nitro-3H-1,3-benzothiazol-2-one;propane |
| SMILES | CCC.O=c1[nH]c2ccc([N+](=O)[O-])cc2s1 |
| InChI | InChI=1S/C7H4N2O3S.C3H8/c10-7-8-5-2-1-4(9(11)12)3-6(5)13-7;1-3-2/h1-3H,(H,8,10);3H2,1-2H3 |
| InChIKey | GZVJZLQUVXKFNM-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 76.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.28 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-nitro-3H-1,3-benzothiazol-2-one;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-nitro-3H-1,3-benzothiazol-2-one;propane?
The IUPAC name of 6-nitro-3H-1,3-benzothiazol-2-one;propane (CID 144618967) is 6-nitro-3H-1,3-benzothiazol-2-one;propane.
What is the SMILES notation for 6-nitro-3H-1,3-benzothiazol-2-one;propane?
The canonical SMILES for 6-nitro-3H-1,3-benzothiazol-2-one;propane is CCC.O=c1[nH]c2ccc([N+](=O)[O-])cc2s1.
What is the InChIKey of 6-nitro-3H-1,3-benzothiazol-2-one;propane?
The InChIKey is GZVJZLQUVXKFNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4N2O3S.C3H8/c10-7-8-5-2-1-4(9(11)12)3-6(5)13-7;1-3-2/h1-3H,(H,8,10);3H2,1-2H3.
What are the key properties of 6-nitro-3H-1,3-benzothiazol-2-one;propane?
6-nitro-3H-1,3-benzothiazol-2-one;propane has a molecular weight of 240.28 g/mol, XLogP of 2.91, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-nitro-3H-1,3-benzothiazol-2-one;propane is sourced from PubChem (CID 144618967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).