About 5-cyclopropyl-2-[3-[7-(2,4-difluorophenyl)-1-methylindol-5-yl]propyl]pyridine-3-carboxylic acid
5-cyclopropyl-2-[3-[7-(2,4-difluorophenyl)-1-methylindol-5-yl]propyl]pyridine-3-carboxylic acid (PubChem CID 144618968) has the molecular formula C27H24F2N2O2
and a molecular weight of 446.50 g/mol. Its IUPAC name is 5-cyclopropyl-2-[3-[7-(2,4-difluorophenyl)-1-methylindol-5-yl]propyl]pyridine-3-carboxylic acid.
Molecular Properties
| Compound Name | 5-cyclopropyl-2-[3-[7-(2,4-difluorophenyl)-1-methylindol-5-yl]propyl]pyridine-3-carboxylic acid |
| PubChem CID | 144618968 |
| Molecular Formula | C27H24F2N2O2 |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | 5-cyclopropyl-2-[3-[7-(2,4-difluorophenyl)-1-methylindol-5-yl]propyl]pyridine-3-carboxylic acid |
| SMILES | Cn1ccc2cc(CCCc3ncc(C4CC4)cc3C(=O)O)cc(-c3ccc(F)cc3F)c21 |
| InChI | InChI=1S/C27H24F2N2O2/c1-31-10-9-18-11-16(12-22(26(18)31)21-8-7-20(28)14-24(21)29)3-2-4-25-23(27(32)33)13-19(15-30-25)17-5-6-17/h7-15,17H,2-6H2,1H3,(H,32,33) |
| InChIKey | CXVULNDJZHJBCH-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-cyclopropyl-2-[3-[7-(2,4-difluorophenyl)-1-methylindol-5-yl]propyl]pyridine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyclopropyl-2-[3-[7-(2,4-difluorophenyl)-1-methylindol-5-yl]propyl]pyridine-3-carboxylic acid?
The IUPAC name of 5-cyclopropyl-2-[3-[7-(2,4-difluorophenyl)-1-methylindol-5-yl]propyl]pyridine-3-carboxylic acid (CID 144618968) is 5-cyclopropyl-2-[3-[7-(2,4-difluorophenyl)-1-methylindol-5-yl]propyl]pyridine-3-carboxylic acid.
What is the SMILES notation for 5-cyclopropyl-2-[3-[7-(2,4-difluorophenyl)-1-methylindol-5-yl]propyl]pyridine-3-carboxylic acid?
The canonical SMILES for 5-cyclopropyl-2-[3-[7-(2,4-difluorophenyl)-1-methylindol-5-yl]propyl]pyridine-3-carboxylic acid is Cn1ccc2cc(CCCc3ncc(C4CC4)cc3C(=O)O)cc(-c3ccc(F)cc3F)c21.
What is the InChIKey of 5-cyclopropyl-2-[3-[7-(2,4-difluorophenyl)-1-methylindol-5-yl]propyl]pyridine-3-carboxylic acid?
The InChIKey is CXVULNDJZHJBCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H24F2N2O2/c1-31-10-9-18-11-16(12-22(26(18)31)21-8-7-20(28)14-24(21)29)3-2-4-25-23(27(32)33)13-19(15-30-25)17-5-6-17/h7-15,17H,2-6H2,1H3,(H,32,33).
What are the key properties of 5-cyclopropyl-2-[3-[7-(2,4-difluorophenyl)-1-methylindol-5-yl]propyl]pyridine-3-carboxylic acid?
5-cyclopropyl-2-[3-[7-(2,4-difluorophenyl)-1-methylindol-5-yl]propyl]pyridine-3-carboxylic acid has a molecular weight of 446.50 g/mol, XLogP of 6.27, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyclopropyl-2-[3-[7-(2,4-difluorophenyl)-1-methylindol-5-yl]propyl]pyridine-3-carboxylic acid is sourced from PubChem (CID 144618968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).