About methanamine;1-(2-phenylethyl)indole
methanamine;1-(2-phenylethyl)indole (PubChem CID 144619116) has the molecular formula C17H20N2
and a molecular weight of 252.36 g/mol. Its IUPAC name is methanamine;1-(2-phenylethyl)indole.
Molecular Properties
| Compound Name | methanamine;1-(2-phenylethyl)indole |
| PubChem CID | 144619116 |
| Molecular Formula | C17H20N2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | methanamine;1-(2-phenylethyl)indole |
| SMILES | CN.c1ccc(CCn2ccc3ccccc32)cc1 |
| InChI | InChI=1S/C16H15N.CH5N/c1-2-6-14(7-3-1)10-12-17-13-11-15-8-4-5-9-16(15)17;1-2/h1-9,11,13H,10,12H2;2H2,1H3 |
| InChIKey | UGNRNMPBRJWARS-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze methanamine;1-(2-phenylethyl)indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanamine;1-(2-phenylethyl)indole?
The IUPAC name of methanamine;1-(2-phenylethyl)indole (CID 144619116) is methanamine;1-(2-phenylethyl)indole.
What is the SMILES notation for methanamine;1-(2-phenylethyl)indole?
The canonical SMILES for methanamine;1-(2-phenylethyl)indole is CN.c1ccc(CCn2ccc3ccccc32)cc1.
What is the InChIKey of methanamine;1-(2-phenylethyl)indole?
The InChIKey is UGNRNMPBRJWARS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15N.CH5N/c1-2-6-14(7-3-1)10-12-17-13-11-15-8-4-5-9-16(15)17;1-2/h1-9,11,13H,10,12H2;2H2,1H3.
What are the key properties of methanamine;1-(2-phenylethyl)indole?
methanamine;1-(2-phenylethyl)indole has a molecular weight of 252.36 g/mol, XLogP of 3.46, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methanamine;1-(2-phenylethyl)indole is sourced from PubChem (CID 144619116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).