C25H22N2O3 — CID 144619139
methyl 5-cyclopropyl-2-[[1-(4-hydroxyphenyl)indol-5-yl]amino]benzoate (PubChem CID 144619139) has the molecular formula C25H22N2O3 and a molecular weight of 398.46 g/mol. Its IUPAC name is methyl 5-cyclopropyl-2-[[1-(4-hydroxyphenyl)indol-5-yl]amino]benzoate.
| Compound Name | methyl 5-cyclopropyl-2-[[1-(4-hydroxyphenyl)indol-5-yl]amino]benzoate |
|---|---|
| PubChem CID | 144619139 |
| Molecular Formula | C25H22N2O3 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | methyl 5-cyclopropyl-2-[[1-(4-hydroxyphenyl)indol-5-yl]amino]benzoate |
| SMILES | COC(=O)c1cc(C2CC2)ccc1Nc1ccc2c(ccn2-c2ccc(O)cc2)c1 |
| InChI | InChI=1S/C25H22N2O3/c1-30-25(29)22-15-17(16-2-3-16)4-10-23(22)26-19-5-11-24-18(14-19)12-13-27(24)20-6-8-21(28)9-7-20/h4-16,26,28H,2-3H2,1H3 |
| InChIKey | PAMCCOYEXQWRSP-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 63.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |