About ethane;(7Z,9Z)-6-methylidene-11,12-dihydro-5H-benzo[10]annulene
ethane;(7Z,9Z)-6-methylidene-11,12-dihydro-5H-benzo[10]annulene (PubChem CID 144619160) has the molecular formula C17H22
and a molecular weight of 226.36 g/mol. Its IUPAC name is ethane;(7Z,9Z)-6-methylidene-11,12-dihydro-5H-benzo[10]annulene.
Molecular Properties
| Compound Name | ethane;(7Z,9Z)-6-methylidene-11,12-dihydro-5H-benzo[10]annulene |
| PubChem CID | 144619160 |
| Molecular Formula | C17H22 |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | ethane;(7Z,9Z)-6-methylidene-11,12-dihydro-5H-benzo[10]annulene |
| SMILES | C=C1/C=C\C=C/CCc2ccccc2C1.CC |
| InChI | InChI=1S/C15H16.C2H6/c1-13-8-4-2-3-5-9-14-10-6-7-11-15(14)12-13;1-2/h2-4,6-8,10-11H,1,5,9,12H2;1-2H3/b3-2-,8-4-; |
| InChIKey | AOIZMMPCWXHLNW-YEKVNHEPSA-N |
| XLogP | 4.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze ethane;(7Z,9Z)-6-methylidene-11,12-dihydro-5H-benzo[10]annulene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(7Z,9Z)-6-methylidene-11,12-dihydro-5H-benzo[10]annulene?
The IUPAC name of ethane;(7Z,9Z)-6-methylidene-11,12-dihydro-5H-benzo[10]annulene (CID 144619160) is ethane;(7Z,9Z)-6-methylidene-11,12-dihydro-5H-benzo[10]annulene.
What is the SMILES notation for ethane;(7Z,9Z)-6-methylidene-11,12-dihydro-5H-benzo[10]annulene?
The canonical SMILES for ethane;(7Z,9Z)-6-methylidene-11,12-dihydro-5H-benzo[10]annulene is C=C1/C=C\C=C/CCc2ccccc2C1.CC.
What is the InChIKey of ethane;(7Z,9Z)-6-methylidene-11,12-dihydro-5H-benzo[10]annulene?
The InChIKey is AOIZMMPCWXHLNW-YEKVNHEPSA-N. The full InChI is InChI=1S/C15H16.C2H6/c1-13-8-4-2-3-5-9-14-10-6-7-11-15(14)12-13;1-2/h2-4,6-8,10-11H,1,5,9,12H2;1-2H3/b3-2-,8-4-;.
What are the key properties of ethane;(7Z,9Z)-6-methylidene-11,12-dihydro-5H-benzo[10]annulene?
ethane;(7Z,9Z)-6-methylidene-11,12-dihydro-5H-benzo[10]annulene has a molecular weight of 226.36 g/mol, XLogP of 4.87, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(7Z,9Z)-6-methylidene-11,12-dihydro-5H-benzo[10]annulene is sourced from PubChem (CID 144619160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).