C15H20N2O3 — CID 144619353
phenyl N-(4-isocyanato-2,4-dimethylpentan-2-yl)carbamate (PubChem CID 144619353) has the molecular formula C15H20N2O3 and a molecular weight of 276.34 g/mol. Its IUPAC name is phenyl N-(4-isocyanato-2,4-dimethylpentan-2-yl)carbamate.
| Compound Name | phenyl N-(4-isocyanato-2,4-dimethylpentan-2-yl)carbamate |
|---|---|
| PubChem CID | 144619353 |
| Molecular Formula | C15H20N2O3 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | phenyl N-(4-isocyanato-2,4-dimethylpentan-2-yl)carbamate |
| SMILES | CC(C)(CC(C)(C)NC(=O)Oc1ccccc1)N=C=O |
| InChI | InChI=1S/C15H20N2O3/c1-14(2,16-11-18)10-15(3,4)17-13(19)20-12-8-6-5-7-9-12/h5-9H,10H2,1-4H3,(H,17,19) |
| InChIKey | RGVUDMFGHZGVQF-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|