About ethane;6-pyridazin-3-yl-5-quinoxalin-2-ylindolo[2,3-b]indole
ethane;6-pyridazin-3-yl-5-quinoxalin-2-ylindolo[2,3-b]indole (PubChem CID 144619418) has the molecular formula C28H22N6
and a molecular weight of 442.53 g/mol. Its IUPAC name is ethane;6-pyridazin-3-yl-5-quinoxalin-2-ylindolo[2,3-b]indole.
Molecular Properties
| Compound Name | ethane;6-pyridazin-3-yl-5-quinoxalin-2-ylindolo[2,3-b]indole |
| PubChem CID | 144619418 |
| Molecular Formula | C28H22N6 |
| Molecular Weight | 442.53 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | ethane;6-pyridazin-3-yl-5-quinoxalin-2-ylindolo[2,3-b]indole |
| SMILES | CC.c1cnnc(-n2c3ccccc3c3c4ccccc4n(-c4cnc5ccccc5n4)c32)c1 |
| InChI | InChI=1S/C26H16N6.C2H6/c1-5-12-21-17(8-1)25-18-9-2-6-13-22(18)32(26(25)31(21)23-14-7-15-28-30-23)24-16-27-19-10-3-4-11-20(19)29-24;1-2/h1-16H;1-2H3 |
| InChIKey | ODMXOJWNFCUXBQ-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 442.53 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethane;6-pyridazin-3-yl-5-quinoxalin-2-ylindolo[2,3-b]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;6-pyridazin-3-yl-5-quinoxalin-2-ylindolo[2,3-b]indole?
The IUPAC name of ethane;6-pyridazin-3-yl-5-quinoxalin-2-ylindolo[2,3-b]indole (CID 144619418) is ethane;6-pyridazin-3-yl-5-quinoxalin-2-ylindolo[2,3-b]indole.
What is the SMILES notation for ethane;6-pyridazin-3-yl-5-quinoxalin-2-ylindolo[2,3-b]indole?
The canonical SMILES for ethane;6-pyridazin-3-yl-5-quinoxalin-2-ylindolo[2,3-b]indole is CC.c1cnnc(-n2c3ccccc3c3c4ccccc4n(-c4cnc5ccccc5n4)c32)c1.
What is the InChIKey of ethane;6-pyridazin-3-yl-5-quinoxalin-2-ylindolo[2,3-b]indole?
The InChIKey is ODMXOJWNFCUXBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H16N6.C2H6/c1-5-12-21-17(8-1)25-18-9-2-6-13-22(18)32(26(25)31(21)23-14-7-15-28-30-23)24-16-27-19-10-3-4-11-20(19)29-24;1-2/h1-16H;1-2H3.
What are the key properties of ethane;6-pyridazin-3-yl-5-quinoxalin-2-ylindolo[2,3-b]indole?
ethane;6-pyridazin-3-yl-5-quinoxalin-2-ylindolo[2,3-b]indole has a molecular weight of 442.53 g/mol, XLogP of 6.49, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;6-pyridazin-3-yl-5-quinoxalin-2-ylindolo[2,3-b]indole is sourced from PubChem (CID 144619418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).