C28H30F3N3O — CID 144619885
N-methyl-4-[2-[4-phenylmethoxy-1-[3-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]butyl]-1H-imidazol-5-yl]aniline (PubChem CID 144619885) has the molecular formula C28H30F3N3O and a molecular weight of 481.56 g/mol. Its IUPAC name is N-methyl-4-[2-[4-phenylmethoxy-1-[3-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]butyl]-1H-imidazol-5-yl]aniline.
| Compound Name | N-methyl-4-[2-[4-phenylmethoxy-1-[3-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]butyl]-1H-imidazol-5-yl]aniline |
|---|---|
| PubChem CID | 144619885 |
| Molecular Formula | C28H30F3N3O |
| Molecular Weight | 481.56 g/mol |
| Exact Mass | 481.23 |
| IUPAC Name | N-methyl-4-[2-[4-phenylmethoxy-1-[3-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]butyl]-1H-imidazol-5-yl]aniline |
| SMILES | CNc1ccc(-c2cnc(C(CCCOCc3ccccc3)C3C=C(C(F)(F)F)C=CC3)[nH]2)cc1 |
| InChI | InChI=1S/C28H30F3N3O/c1-32-24-14-12-21(13-15-24)26-18-33-27(34-26)25(22-9-5-10-23(17-22)28(29,30)31)11-6-16-35-19-20-7-3-2-4-8-20/h2-5,7-8,10,12-15,17-18,22,25,32H,6,9,11,16,19H2,1H3,(H,33,34) |
| InChIKey | XOBZNCCDTYUVIV-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 49.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.56 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|