C17H24N4OS — CID 144620106
1-(3-cyclohexyl-12-thia-3,5,8-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,10-pentaen-4-yl)ethanol;methanamine (PubChem CID 144620106) has the molecular formula C17H24N4OS and a molecular weight of 332.47 g/mol. Its IUPAC name is 1-(3-cyclohexyl-12-thia-3,5,8-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,10-pentaen-4-yl)ethanol;methanamine.
| Compound Name | 1-(3-cyclohexyl-12-thia-3,5,8-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,10-pentaen-4-yl)ethanol;methanamine |
|---|---|
| PubChem CID | 144620106 |
| Molecular Formula | C17H24N4OS |
| Molecular Weight | 332.47 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | 1-(3-cyclohexyl-12-thia-3,5,8-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,10-pentaen-4-yl)ethanol;methanamine |
| SMILES | CC(O)c1nc2cnc3ccsc3c2n1C1CCCCC1.CN |
| InChI | InChI=1S/C16H19N3OS.CH5N/c1-10(20)16-18-13-9-17-12-7-8-21-15(12)14(13)19(16)11-5-3-2-4-6-11;1-2/h7-11,20H,2-6H2,1H3;2H2,1H3 |
| InChIKey | QYGZGLWVXPDJGO-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.47 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |