About acetyloxymethyl 2-(2-methylimidazol-1-yl)benzoate;acetyloxymethyl 2-pyrrol-1-ylbenzoate;propan-2-one
acetyloxymethyl 2-(2-methylimidazol-1-yl)benzoate;acetyloxymethyl 2-pyrrol-1-ylbenzoate;propan-2-one (PubChem CID 144620705) has the molecular formula C31H33N3O9
and a molecular weight of 591.62 g/mol. Its IUPAC name is acetyloxymethyl 2-(2-methylimidazol-1-yl)benzoate;acetyloxymethyl 2-pyrrol-1-ylbenzoate;propan-2-one.
Molecular Properties
| Compound Name | acetyloxymethyl 2-(2-methylimidazol-1-yl)benzoate;acetyloxymethyl 2-pyrrol-1-ylbenzoate;propan-2-one |
| PubChem CID | 144620705 |
| Molecular Formula | C31H33N3O9 |
| Molecular Weight | 591.62 g/mol |
| Exact Mass | 591.22 |
| IUPAC Name | acetyloxymethyl 2-(2-methylimidazol-1-yl)benzoate;acetyloxymethyl 2-pyrrol-1-ylbenzoate;propan-2-one |
| SMILES | CC(=O)OCOC(=O)c1ccccc1-n1cccc1.CC(=O)OCOC(=O)c1ccccc1-n1ccnc1C.CC(C)=O |
| InChI | InChI=1S/C14H14N2O4.C14H13NO4.C3H6O/c1-10-15-7-8-16(10)13-6-4-3-5-12(13)14(18)20-9-19-11(2)17;1-11(16)18-10-19-14(17)12-6-2-3-7-13(12)15-8-4-5-9-15;1-3(2)4/h3-8H,9H2,1-2H3;2-9H,10H2,1H3;1-2H3 |
| InChIKey | UVGWRCLYLDYAIN-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 145.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 591.62 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze acetyloxymethyl 2-(2-methylimidazol-1-yl)benzoate;acetyloxymethyl 2-pyrrol-1-ylbenzoate;propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetyloxymethyl 2-(2-methylimidazol-1-yl)benzoate;acetyloxymethyl 2-pyrrol-1-ylbenzoate;propan-2-one?
The IUPAC name of acetyloxymethyl 2-(2-methylimidazol-1-yl)benzoate;acetyloxymethyl 2-pyrrol-1-ylbenzoate;propan-2-one (CID 144620705) is acetyloxymethyl 2-(2-methylimidazol-1-yl)benzoate;acetyloxymethyl 2-pyrrol-1-ylbenzoate;propan-2-one.
What is the SMILES notation for acetyloxymethyl 2-(2-methylimidazol-1-yl)benzoate;acetyloxymethyl 2-pyrrol-1-ylbenzoate;propan-2-one?
The canonical SMILES for acetyloxymethyl 2-(2-methylimidazol-1-yl)benzoate;acetyloxymethyl 2-pyrrol-1-ylbenzoate;propan-2-one is CC(=O)OCOC(=O)c1ccccc1-n1cccc1.CC(=O)OCOC(=O)c1ccccc1-n1ccnc1C.CC(C)=O.
What is the InChIKey of acetyloxymethyl 2-(2-methylimidazol-1-yl)benzoate;acetyloxymethyl 2-pyrrol-1-ylbenzoate;propan-2-one?
The InChIKey is UVGWRCLYLDYAIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N2O4.C14H13NO4.C3H6O/c1-10-15-7-8-16(10)13-6-4-3-5-12(13)14(18)20-9-19-11(2)17;1-11(16)18-10-19-14(17)12-6-2-3-7-13(12)15-8-4-5-9-15;1-3(2)4/h3-8H,9H2,1-2H3;2-9H,10H2,1H3;1-2H3.
What are the key properties of acetyloxymethyl 2-(2-methylimidazol-1-yl)benzoate;acetyloxymethyl 2-pyrrol-1-ylbenzoate;propan-2-one?
acetyloxymethyl 2-(2-methylimidazol-1-yl)benzoate;acetyloxymethyl 2-pyrrol-1-ylbenzoate;propan-2-one has a molecular weight of 591.62 g/mol, XLogP of 4.61, 8 rotatable bonds, 0 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for acetyloxymethyl 2-(2-methylimidazol-1-yl)benzoate;acetyloxymethyl 2-pyrrol-1-ylbenzoate;propan-2-one is sourced from PubChem (CID 144620705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).