C31H34N2O4 — CID 144620726
2-(2,5-dimethylpyrrol-1-yl)benzoic acid;ethane;2-(2-methyl-2,3-dihydroindol-1-yl)benzoic acid (PubChem CID 144620726) has the molecular formula C31H34N2O4 and a molecular weight of 498.62 g/mol. Its IUPAC name is 2-(2,5-dimethylpyrrol-1-yl)benzoic acid;ethane;2-(2-methyl-2,3-dihydroindol-1-yl)benzoic acid.
| Compound Name | 2-(2,5-dimethylpyrrol-1-yl)benzoic acid;ethane;2-(2-methyl-2,3-dihydroindol-1-yl)benzoic acid |
|---|---|
| PubChem CID | 144620726 |
| Molecular Formula | C31H34N2O4 |
| Molecular Weight | 498.62 g/mol |
| Exact Mass | 498.25 |
| IUPAC Name | 2-(2,5-dimethylpyrrol-1-yl)benzoic acid;ethane;2-(2-methyl-2,3-dihydroindol-1-yl)benzoic acid |
| SMILES | CC.CC1Cc2ccccc2N1c1ccccc1C(=O)O.Cc1ccc(C)n1-c1ccccc1C(=O)O |
| InChI | InChI=1S/C16H15NO2.C13H13NO2.C2H6/c1-11-10-12-6-2-4-8-14(12)17(11)15-9-5-3-7-13(15)16(18)19;1-9-7-8-10(2)14(9)12-6-4-3-5-11(12)13(15)16;1-2/h2-9,11H,10H2,1H3,(H,18,19);3-8H,1-2H3,(H,15,16);1-2H3 |
| InChIKey | UTWMPDXVBNHQJS-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 82.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.62 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|