C32H39ClN4O3S — CID 144621601
N-(4-chloro-3-quinazolin-2-ylphenyl)-2-methyl-4-(1,4,3-oxathiazinan-3-yl)benzamide;ethane;1-ethoxypropane (PubChem CID 144621601) has the molecular formula C32H39ClN4O3S and a molecular weight of 595.21 g/mol. Its IUPAC name is N-(4-chloro-3-quinazolin-2-ylphenyl)-2-methyl-4-(1,4,3-oxathiazinan-3-yl)benzamide;ethane;1-ethoxypropane.
| Compound Name | N-(4-chloro-3-quinazolin-2-ylphenyl)-2-methyl-4-(1,4,3-oxathiazinan-3-yl)benzamide;ethane;1-ethoxypropane |
|---|---|
| PubChem CID | 144621601 |
| Molecular Formula | C32H39ClN4O3S |
| Molecular Weight | 595.21 g/mol |
| Exact Mass | 594.24 |
| IUPAC Name | N-(4-chloro-3-quinazolin-2-ylphenyl)-2-methyl-4-(1,4,3-oxathiazinan-3-yl)benzamide;ethane;1-ethoxypropane |
| SMILES | CC.CCCOCC.Cc1cc(N2COCCS2)ccc1C(=O)Nc1ccc(Cl)c(-c2ncc3ccccc3n2)c1 |
| InChI | InChI=1S/C25H21ClN4O2S.C5H12O.C2H6/c1-16-12-19(30-15-32-10-11-33-30)7-8-20(16)25(31)28-18-6-9-22(26)21(13-18)24-27-14-17-4-2-3-5-23(17)29-24;1-3-5-6-4-2;1-2/h2-9,12-14H,10-11,15H2,1H3,(H,28,31);3-5H2,1-2H3;1-2H3 |
| InChIKey | IYSURSVIULERFS-UHFFFAOYSA-N |
| XLogP | 8.41 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.21 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|