About [3-[(3-cyclopropyl-1,2,4-oxadiazol-5-yl)methoxy]-4-(3-methylpyrazin-2-yl)phenyl]oxidanium
[3-[(3-cyclopropyl-1,2,4-oxadiazol-5-yl)methoxy]-4-(3-methylpyrazin-2-yl)phenyl]oxidanium (PubChem CID 144623451) has the molecular formula C17H17N4O3+
and a molecular weight of 325.35 g/mol. Its IUPAC name is [3-[(3-cyclopropyl-1,2,4-oxadiazol-5-yl)methoxy]-4-(3-methylpyrazin-2-yl)phenyl]oxidanium.
Molecular Properties
| Compound Name | [3-[(3-cyclopropyl-1,2,4-oxadiazol-5-yl)methoxy]-4-(3-methylpyrazin-2-yl)phenyl]oxidanium |
| PubChem CID | 144623451 |
| Molecular Formula | C17H17N4O3+ |
| Molecular Weight | 325.35 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | [3-[(3-cyclopropyl-1,2,4-oxadiazol-5-yl)methoxy]-4-(3-methylpyrazin-2-yl)phenyl]oxidanium |
| SMILES | Cc1nccnc1-c1ccc([OH2+])cc1OCc1nc(C2CC2)no1 |
| InChI | InChI=1S/C17H16N4O3/c1-10-16(19-7-6-18-10)13-5-4-12(22)8-14(13)23-9-15-20-17(21-24-15)11-2-3-11/h4-8,11,22H,2-3,9H2,1H3/p+1 |
| InChIKey | MZXHSEPBZPGBTQ-UHFFFAOYSA-O |
| XLogP | 2.73 |
| TPSA | 96.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.35 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze [3-[(3-cyclopropyl-1,2,4-oxadiazol-5-yl)methoxy]-4-(3-methylpyrazin-2-yl)phenyl]oxidanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[(3-cyclopropyl-1,2,4-oxadiazol-5-yl)methoxy]-4-(3-methylpyrazin-2-yl)phenyl]oxidanium?
The IUPAC name of [3-[(3-cyclopropyl-1,2,4-oxadiazol-5-yl)methoxy]-4-(3-methylpyrazin-2-yl)phenyl]oxidanium (CID 144623451) is [3-[(3-cyclopropyl-1,2,4-oxadiazol-5-yl)methoxy]-4-(3-methylpyrazin-2-yl)phenyl]oxidanium.
What is the SMILES notation for [3-[(3-cyclopropyl-1,2,4-oxadiazol-5-yl)methoxy]-4-(3-methylpyrazin-2-yl)phenyl]oxidanium?
The canonical SMILES for [3-[(3-cyclopropyl-1,2,4-oxadiazol-5-yl)methoxy]-4-(3-methylpyrazin-2-yl)phenyl]oxidanium is Cc1nccnc1-c1ccc([OH2+])cc1OCc1nc(C2CC2)no1.
What is the InChIKey of [3-[(3-cyclopropyl-1,2,4-oxadiazol-5-yl)methoxy]-4-(3-methylpyrazin-2-yl)phenyl]oxidanium?
The InChIKey is MZXHSEPBZPGBTQ-UHFFFAOYSA-O. The full InChI is InChI=1S/C17H16N4O3/c1-10-16(19-7-6-18-10)13-5-4-12(22)8-14(13)23-9-15-20-17(21-24-15)11-2-3-11/h4-8,11,22H,2-3,9H2,1H3/p+1.
What are the key properties of [3-[(3-cyclopropyl-1,2,4-oxadiazol-5-yl)methoxy]-4-(3-methylpyrazin-2-yl)phenyl]oxidanium?
[3-[(3-cyclopropyl-1,2,4-oxadiazol-5-yl)methoxy]-4-(3-methylpyrazin-2-yl)phenyl]oxidanium has a molecular weight of 325.35 g/mol, XLogP of 2.73, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[(3-cyclopropyl-1,2,4-oxadiazol-5-yl)methoxy]-4-(3-methylpyrazin-2-yl)phenyl]oxidanium is sourced from PubChem (CID 144623451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).