C17H18N3O3+ — CID 144623485
[3-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-4-(3-methylpyrazin-2-yl)phenyl]oxidanium (PubChem CID 144623485) has the molecular formula C17H18N3O3+ and a molecular weight of 312.35 g/mol. Its IUPAC name is [3-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-4-(3-methylpyrazin-2-yl)phenyl]oxidanium.
| Compound Name | [3-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-4-(3-methylpyrazin-2-yl)phenyl]oxidanium |
|---|---|
| PubChem CID | 144623485 |
| Molecular Formula | C17H18N3O3+ |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | [3-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-4-(3-methylpyrazin-2-yl)phenyl]oxidanium |
| SMILES | Cc1nccnc1-c1ccc([OH2+])cc1OCc1c(C)noc1C |
| InChI | InChI=1S/C17H17N3O3/c1-10-15(12(3)23-20-10)9-22-16-8-13(21)4-5-14(16)17-11(2)18-6-7-19-17/h4-8,21H,9H2,1-3H3/p+1 |
| InChIKey | OLRWBKADGLULHI-UHFFFAOYSA-O |
| XLogP | 3.07 |
| TPSA | 83.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|