C9H17NO — CID 144623593
ethanamine;(2E,4Z)-hepta-2,4,6-trien-3-ol (PubChem CID 144623593) has the molecular formula C9H17NO and a molecular weight of 155.24 g/mol. Its IUPAC name is ethanamine;(2E,4Z)-hepta-2,4,6-trien-3-ol.
| Compound Name | ethanamine;(2E,4Z)-hepta-2,4,6-trien-3-ol |
|---|---|
| PubChem CID | 144623593 |
| Molecular Formula | C9H17NO |
| Molecular Weight | 155.24 g/mol |
| Exact Mass | 155.13 |
| IUPAC Name | ethanamine;(2E,4Z)-hepta-2,4,6-trien-3-ol |
| SMILES | C=C/C=C\C(O)=C/C.CCN |
| InChI | InChI=1S/C7H10O.C2H7N/c1-3-5-6-7(8)4-2;1-2-3/h3-6,8H,1H2,2H3;2-3H2,1H3/b6-5-,7-4+; |
| InChIKey | DSKFHAMOBWQULR-BIFKCLKRSA-N |
| XLogP | 2.16 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.24 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|