C22H24F2N4O2S — CID 144623679
N-[3-(3,3-difluorobutyl)-5-[(E)-3-oxo-3-[4-(1,3-thiazol-4-ylmethylidene)piperidin-1-yl]prop-1-enyl]-2-pyridinyl]formamide (PubChem CID 144623679) has the molecular formula C22H24F2N4O2S and a molecular weight of 446.52 g/mol. Its IUPAC name is N-[3-(3,3-difluorobutyl)-5-[(E)-3-oxo-3-[4-(1,3-thiazol-4-ylmethylidene)piperidin-1-yl]prop-1-enyl]-2-pyridinyl]formamide.
| Compound Name | N-[3-(3,3-difluorobutyl)-5-[(E)-3-oxo-3-[4-(1,3-thiazol-4-ylmethylidene)piperidin-1-yl]prop-1-enyl]-2-pyridinyl]formamide |
|---|---|
| PubChem CID | 144623679 |
| Molecular Formula | C22H24F2N4O2S |
| Molecular Weight | 446.52 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | N-[3-(3,3-difluorobutyl)-5-[(E)-3-oxo-3-[4-(1,3-thiazol-4-ylmethylidene)piperidin-1-yl]prop-1-enyl]-2-pyridinyl]formamide |
| SMILES | CC(F)(F)CCc1cc(/C=C/C(=O)N2CCC(=Cc3cscn3)CC2)cnc1NC=O |
| InChI | InChI=1S/C22H24F2N4O2S/c1-22(23,24)7-4-18-10-17(12-25-21(18)26-14-29)2-3-20(30)28-8-5-16(6-9-28)11-19-13-31-15-27-19/h2-3,10-15H,4-9H2,1H3,(H,25,26,29)/b3-2+ |
| InChIKey | SGVACBYDMJXPKY-NSCUHMNNSA-N |
| XLogP | 4.41 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.52 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|