C9H10N2O — CID 144623693
1,2,5,9-tetrahydropyrido[2,3-b]azepin-8-one (PubChem CID 144623693) has the molecular formula C9H10N2O and a molecular weight of 162.19 g/mol. Its IUPAC name is 1,2,5,9-tetrahydropyrido[2,3-b]azepin-8-one.
| Compound Name | 1,2,5,9-tetrahydropyrido[2,3-b]azepin-8-one |
|---|---|
| PubChem CID | 144623693 |
| Molecular Formula | C9H10N2O |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.08 |
| IUPAC Name | 1,2,5,9-tetrahydropyrido[2,3-b]azepin-8-one |
| SMILES | O=C1C=CCC2=C(NCC=C2)N1 |
| InChI | InChI=1S/C9H10N2O/c12-8-5-1-3-7-4-2-6-10-9(7)11-8/h1-2,4-5,10H,3,6H2,(H,11,12) |
| InChIKey | FRMMIMIHRBTGIN-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |