C34H28FN5O — CID 144623778
N-fluoro-N-[2-[4-[1-(2-methylphenyl)imidazol-2-yl]dibenzofuran-3-yl]propan-2-yl]-2-pyrazol-1-ylaniline (PubChem CID 144623778) has the molecular formula C34H28FN5O and a molecular weight of 541.63 g/mol. Its IUPAC name is N-fluoro-N-[2-[4-[1-(2-methylphenyl)imidazol-2-yl]dibenzofuran-3-yl]propan-2-yl]-2-pyrazol-1-ylaniline.
| Compound Name | N-fluoro-N-[2-[4-[1-(2-methylphenyl)imidazol-2-yl]dibenzofuran-3-yl]propan-2-yl]-2-pyrazol-1-ylaniline |
|---|---|
| PubChem CID | 144623778 |
| Molecular Formula | C34H28FN5O |
| Molecular Weight | 541.63 g/mol |
| Exact Mass | 541.23 |
| IUPAC Name | N-fluoro-N-[2-[4-[1-(2-methylphenyl)imidazol-2-yl]dibenzofuran-3-yl]propan-2-yl]-2-pyrazol-1-ylaniline |
| SMILES | Cc1ccccc1-n1ccnc1-c1c(C(C)(C)N(F)c2ccccc2-n2cccn2)ccc2c1oc1ccccc12 |
| InChI | InChI=1S/C34H28FN5O/c1-23-11-4-6-13-27(23)38-22-20-36-33(38)31-26(18-17-25-24-12-5-9-16-30(24)41-32(25)31)34(2,3)40(35)29-15-8-7-14-28(29)39-21-10-19-37-39/h4-22H,1-3H3 |
| InChIKey | XZAZXMHFJPHDAP-UHFFFAOYSA-N |
| XLogP | 8.56 |
| TPSA | 52.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.63 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|