About 2,2-dimethyl-3-[4-(trifluoromethyl)phenyl]sulfanylpropan-1-ol;ethane
2,2-dimethyl-3-[4-(trifluoromethyl)phenyl]sulfanylpropan-1-ol;ethane (PubChem CID 144624044) has the molecular formula C14H21F3OS
and a molecular weight of 294.38 g/mol. Its IUPAC name is 2,2-dimethyl-3-[4-(trifluoromethyl)phenyl]sulfanylpropan-1-ol;ethane.
Molecular Properties
| Compound Name | 2,2-dimethyl-3-[4-(trifluoromethyl)phenyl]sulfanylpropan-1-ol;ethane |
| PubChem CID | 144624044 |
| Molecular Formula | C14H21F3OS |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | 2,2-dimethyl-3-[4-(trifluoromethyl)phenyl]sulfanylpropan-1-ol;ethane |
| SMILES | CC.CC(C)(CO)CSc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H15F3OS.C2H6/c1-11(2,7-16)8-17-10-5-3-9(4-6-10)12(13,14)15;1-2/h3-6,16H,7-8H2,1-2H3;1-2H3 |
| InChIKey | BIDIJHODEBSYLZ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,2-dimethyl-3-[4-(trifluoromethyl)phenyl]sulfanylpropan-1-ol;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyl-3-[4-(trifluoromethyl)phenyl]sulfanylpropan-1-ol;ethane?
The IUPAC name of 2,2-dimethyl-3-[4-(trifluoromethyl)phenyl]sulfanylpropan-1-ol;ethane (CID 144624044) is 2,2-dimethyl-3-[4-(trifluoromethyl)phenyl]sulfanylpropan-1-ol;ethane.
What is the SMILES notation for 2,2-dimethyl-3-[4-(trifluoromethyl)phenyl]sulfanylpropan-1-ol;ethane?
The canonical SMILES for 2,2-dimethyl-3-[4-(trifluoromethyl)phenyl]sulfanylpropan-1-ol;ethane is CC.CC(C)(CO)CSc1ccc(C(F)(F)F)cc1.
What is the InChIKey of 2,2-dimethyl-3-[4-(trifluoromethyl)phenyl]sulfanylpropan-1-ol;ethane?
The InChIKey is BIDIJHODEBSYLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15F3OS.C2H6/c1-11(2,7-16)8-17-10-5-3-9(4-6-10)12(13,14)15;1-2/h3-6,16H,7-8H2,1-2H3;1-2H3.
What are the key properties of 2,2-dimethyl-3-[4-(trifluoromethyl)phenyl]sulfanylpropan-1-ol;ethane?
2,2-dimethyl-3-[4-(trifluoromethyl)phenyl]sulfanylpropan-1-ol;ethane has a molecular weight of 294.38 g/mol, XLogP of 4.84, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-3-[4-(trifluoromethyl)phenyl]sulfanylpropan-1-ol;ethane is sourced from PubChem (CID 144624044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).