C20H23N — CID 144624134
N-[(2E,5Z)-hepta-2,5-dien-2-yl]-2-phenylcyclohepta-1,3,6-trien-1-amine (PubChem CID 144624134) has the molecular formula C20H23N and a molecular weight of 277.41 g/mol. Its IUPAC name is N-[(2E,5Z)-hepta-2,5-dien-2-yl]-2-phenylcyclohepta-1,3,6-trien-1-amine.
| Compound Name | N-[(2E,5Z)-hepta-2,5-dien-2-yl]-2-phenylcyclohepta-1,3,6-trien-1-amine |
|---|---|
| PubChem CID | 144624134 |
| Molecular Formula | C20H23N |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | N-[(2E,5Z)-hepta-2,5-dien-2-yl]-2-phenylcyclohepta-1,3,6-trien-1-amine |
| SMILES | C/C=C\C/C=C(\C)NC1=C(c2ccccc2)C=CCC=C1 |
| InChI | InChI=1S/C20H23N/c1-3-4-7-12-17(2)21-20-16-11-6-10-15-19(20)18-13-8-5-9-14-18/h3-5,8-16,21H,6-7H2,1-2H3/b4-3-,17-12+ |
| InChIKey | XDLGUGHYONOFSZ-ONIZNANUSA-N |
| XLogP | 5.37 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|