C12H20O5 — CID 14462488
2-[5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-1,3-dioxolan-4-yl]acetaldehyde (PubChem CID 14462488) has the molecular formula C12H20O5 and a molecular weight of 244.29 g/mol. Its IUPAC name is 2-[5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-1,3-dioxolan-4-yl]acetaldehyde.
| Compound Name | 2-[5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-1,3-dioxolan-4-yl]acetaldehyde |
|---|---|
| PubChem CID | 14462488 |
| Molecular Formula | C12H20O5 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 2-[5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-1,3-dioxolan-4-yl]acetaldehyde |
| SMILES | CC1(C)OCC(C2OC(C)(C)OC2CC=O)O1 |
| InChI | InChI=1S/C12H20O5/c1-11(2)14-7-9(16-11)10-8(5-6-13)15-12(3,4)17-10/h6,8-10H,5,7H2,1-4H3 |
| InChIKey | HXJGDZFHIDPMRX-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|