C7H8Al2N4O — CID 144625109
CID 144625109 (PubChem CID 144625109) has the molecular formula C7H8Al2N4O and a molecular weight of 218.13 g/mol.
| Compound Name | CID 144625109 |
|---|---|
| PubChem CID | 144625109 |
| Molecular Formula | C7H8Al2N4O |
| Molecular Weight | 218.13 g/mol |
| Exact Mass | 218.03 |
| IUPAC Name | — |
| SMILES | CNC(=O)c1cnc(N[Al])cc1N[Al] |
| InChI | InChI=1S/C7H9N4O.2Al/c1-10-7(12)4-3-11-6(9)2-5(4)8;;/h2-3H,1H3,(H4-,8,9,10,11,12);;/q-1;2*+1/p-1 |
| InChIKey | ASXVFTXDOXKCSW-UHFFFAOYSA-M |
| XLogP | -0.57 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.13 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |