About 6-methylsulfanyl-N-prop-1-en-2-ylcyclohexa-1,5-dien-1-amine
6-methylsulfanyl-N-prop-1-en-2-ylcyclohexa-1,5-dien-1-amine (PubChem CID 144625342) has the molecular formula C10H15NS
and a molecular weight of 181.30 g/mol. Its IUPAC name is 6-methylsulfanyl-N-prop-1-en-2-ylcyclohexa-1,5-dien-1-amine.
Molecular Properties
| Compound Name | 6-methylsulfanyl-N-prop-1-en-2-ylcyclohexa-1,5-dien-1-amine |
| PubChem CID | 144625342 |
| Molecular Formula | C10H15NS |
| Molecular Weight | 181.30 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | 6-methylsulfanyl-N-prop-1-en-2-ylcyclohexa-1,5-dien-1-amine |
| SMILES | C=C(C)NC1=CCCC=C1SC |
| InChI | InChI=1S/C10H15NS/c1-8(2)11-9-6-4-5-7-10(9)12-3/h6-7,11H,1,4-5H2,2-3H3 |
| InChIKey | ZWSUWHXUUIBLGK-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.30 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-methylsulfanyl-N-prop-1-en-2-ylcyclohexa-1,5-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methylsulfanyl-N-prop-1-en-2-ylcyclohexa-1,5-dien-1-amine?
The IUPAC name of 6-methylsulfanyl-N-prop-1-en-2-ylcyclohexa-1,5-dien-1-amine (CID 144625342) is 6-methylsulfanyl-N-prop-1-en-2-ylcyclohexa-1,5-dien-1-amine.
What is the SMILES notation for 6-methylsulfanyl-N-prop-1-en-2-ylcyclohexa-1,5-dien-1-amine?
The canonical SMILES for 6-methylsulfanyl-N-prop-1-en-2-ylcyclohexa-1,5-dien-1-amine is C=C(C)NC1=CCCC=C1SC.
What is the InChIKey of 6-methylsulfanyl-N-prop-1-en-2-ylcyclohexa-1,5-dien-1-amine?
The InChIKey is ZWSUWHXUUIBLGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NS/c1-8(2)11-9-6-4-5-7-10(9)12-3/h6-7,11H,1,4-5H2,2-3H3.
What are the key properties of 6-methylsulfanyl-N-prop-1-en-2-ylcyclohexa-1,5-dien-1-amine?
6-methylsulfanyl-N-prop-1-en-2-ylcyclohexa-1,5-dien-1-amine has a molecular weight of 181.30 g/mol, XLogP of 3.03, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methylsulfanyl-N-prop-1-en-2-ylcyclohexa-1,5-dien-1-amine is sourced from PubChem (CID 144625342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).