C22H26F3N5O2 — CID 144626491
(3Z)-5-N-(2-methoxyethyl)-5-N-methyl-2-N-[4-(4,5,6,7-tetrahydrofuro[3,2-c]pyridin-2-yl)-5-(trifluoromethyl)pyrimidin-2-yl]hexa-1,3,5-triene-2,5-diamine (PubChem CID 144626491) has the molecular formula C22H26F3N5O2 and a molecular weight of 449.48 g/mol. Its IUPAC name is (3Z)-5-N-(2-methoxyethyl)-5-N-methyl-2-N-[4-(4,5,6,7-tetrahydrofuro[3,2-c]pyridin-2-yl)-5-(trifluoromethyl)pyrimidin-2-yl]hexa-1,3,5-triene-2,5-diamine.
| Compound Name | (3Z)-5-N-(2-methoxyethyl)-5-N-methyl-2-N-[4-(4,5,6,7-tetrahydrofuro[3,2-c]pyridin-2-yl)-5-(trifluoromethyl)pyrimidin-2-yl]hexa-1,3,5-triene-2,5-diamine |
|---|---|
| PubChem CID | 144626491 |
| Molecular Formula | C22H26F3N5O2 |
| Molecular Weight | 449.48 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | (3Z)-5-N-(2-methoxyethyl)-5-N-methyl-2-N-[4-(4,5,6,7-tetrahydrofuro[3,2-c]pyridin-2-yl)-5-(trifluoromethyl)pyrimidin-2-yl]hexa-1,3,5-triene-2,5-diamine |
| SMILES | C=C(/C=C\C(=C)N(C)CCOC)Nc1ncc(C(F)(F)F)c(-c2cc3c(o2)CCNC3)n1 |
| InChI | InChI=1S/C22H26F3N5O2/c1-14(5-6-15(2)30(3)9-10-31-4)28-21-27-13-17(22(23,24)25)20(29-21)19-11-16-12-26-8-7-18(16)32-19/h5-6,11,13,26H,1-2,7-10,12H2,3-4H3,(H,27,28,29)/b6-5- |
| InChIKey | OJVLCHWSXABBCL-WAYWQWQTSA-N |
| XLogP | 3.97 |
| TPSA | 75.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.48 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|