C18H26N7OS+ — CID 144626748
ethyl-[(3S)-3-[8-(1-ethyl-5-methylpyrazol-4-yl)-9-methylpurin-6-yl]oxypyrrolidin-1-yl]sulfanium (PubChem CID 144626748) has the molecular formula C18H26N7OS+ and a molecular weight of 388.52 g/mol. Its IUPAC name is ethyl-[(3S)-3-[8-(1-ethyl-5-methylpyrazol-4-yl)-9-methylpurin-6-yl]oxypyrrolidin-1-yl]sulfanium.
| Compound Name | ethyl-[(3S)-3-[8-(1-ethyl-5-methylpyrazol-4-yl)-9-methylpurin-6-yl]oxypyrrolidin-1-yl]sulfanium |
|---|---|
| PubChem CID | 144626748 |
| Molecular Formula | C18H26N7OS+ |
| Molecular Weight | 388.52 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | ethyl-[(3S)-3-[8-(1-ethyl-5-methylpyrazol-4-yl)-9-methylpurin-6-yl]oxypyrrolidin-1-yl]sulfanium |
| SMILES | CC[SH+]N1CC[C@H](Oc2ncnc3c2nc(-c2cnn(CC)c2C)n3C)C1 |
| InChI | InChI=1S/C18H25N7OS/c1-5-25-12(3)14(9-21-25)16-22-15-17(23(16)4)19-11-20-18(15)26-13-7-8-24(10-13)27-6-2/h9,11,13H,5-8,10H2,1-4H3/p+1/t13-/m0/s1 |
| InChIKey | GSLAQDMDBSKXPQ-ZDUSSCGKSA-O |
| XLogP | 1.76 |
| TPSA | 73.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.52 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|