About 2-chloro-N-[(1R,3S)-3-(ethylcarbamoylamino)cyclopentyl]-N-methyl-4-phenylbenzamide
2-chloro-N-[(1R,3S)-3-(ethylcarbamoylamino)cyclopentyl]-N-methyl-4-phenylbenzamide (PubChem CID 144627034) has the molecular formula C22H26ClN3O2
and a molecular weight of 399.92 g/mol. Its IUPAC name is 2-chloro-N-[(1R,3S)-3-(ethylcarbamoylamino)cyclopentyl]-N-methyl-4-phenylbenzamide.
Molecular Properties
| Compound Name | 2-chloro-N-[(1R,3S)-3-(ethylcarbamoylamino)cyclopentyl]-N-methyl-4-phenylbenzamide |
| PubChem CID | 144627034 |
| Molecular Formula | C22H26ClN3O2 |
| Molecular Weight | 399.92 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | 2-chloro-N-[(1R,3S)-3-(ethylcarbamoylamino)cyclopentyl]-N-methyl-4-phenylbenzamide |
| SMILES | CCNC(=O)N[C@H]1CC[C@@H](N(C)C(=O)c2ccc(-c3ccccc3)cc2Cl)C1 |
| InChI | InChI=1S/C22H26ClN3O2/c1-3-24-22(28)25-17-10-11-18(14-17)26(2)21(27)19-12-9-16(13-20(19)23)15-7-5-4-6-8-15/h4-9,12-13,17-18H,3,10-11,14H2,1-2H3,(H2,24,25,28)/t17-,18+/m0/s1 |
| InChIKey | DCCRPYVMWJXKMD-ZWKOTPCHSA-N |
| XLogP | 4.32 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.92 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-chloro-N-[(1R,3S)-3-(ethylcarbamoylamino)cyclopentyl]-N-methyl-4-phenylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-[(1R,3S)-3-(ethylcarbamoylamino)cyclopentyl]-N-methyl-4-phenylbenzamide?
The IUPAC name of 2-chloro-N-[(1R,3S)-3-(ethylcarbamoylamino)cyclopentyl]-N-methyl-4-phenylbenzamide (CID 144627034) is 2-chloro-N-[(1R,3S)-3-(ethylcarbamoylamino)cyclopentyl]-N-methyl-4-phenylbenzamide.
What is the SMILES notation for 2-chloro-N-[(1R,3S)-3-(ethylcarbamoylamino)cyclopentyl]-N-methyl-4-phenylbenzamide?
The canonical SMILES for 2-chloro-N-[(1R,3S)-3-(ethylcarbamoylamino)cyclopentyl]-N-methyl-4-phenylbenzamide is CCNC(=O)N[C@H]1CC[C@@H](N(C)C(=O)c2ccc(-c3ccccc3)cc2Cl)C1.
What is the InChIKey of 2-chloro-N-[(1R,3S)-3-(ethylcarbamoylamino)cyclopentyl]-N-methyl-4-phenylbenzamide?
The InChIKey is DCCRPYVMWJXKMD-ZWKOTPCHSA-N. The full InChI is InChI=1S/C22H26ClN3O2/c1-3-24-22(28)25-17-10-11-18(14-17)26(2)21(27)19-12-9-16(13-20(19)23)15-7-5-4-6-8-15/h4-9,12-13,17-18H,3,10-11,14H2,1-2H3,(H2,24,25,28)/t17-,18+/m0/s1.
What are the key properties of 2-chloro-N-[(1R,3S)-3-(ethylcarbamoylamino)cyclopentyl]-N-methyl-4-phenylbenzamide?
2-chloro-N-[(1R,3S)-3-(ethylcarbamoylamino)cyclopentyl]-N-methyl-4-phenylbenzamide has a molecular weight of 399.92 g/mol, XLogP of 4.32, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-[(1R,3S)-3-(ethylcarbamoylamino)cyclopentyl]-N-methyl-4-phenylbenzamide is sourced from PubChem (CID 144627034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).