About 2-fluoro-6-methyl-4-(methylsulfanylmethyl)pyridine;2,2,2-trifluoroacetamide
2-fluoro-6-methyl-4-(methylsulfanylmethyl)pyridine;2,2,2-trifluoroacetamide (PubChem CID 144627184) has the molecular formula C10H12F4N2OS
and a molecular weight of 284.28 g/mol. Its IUPAC name is 2-fluoro-6-methyl-4-(methylsulfanylmethyl)pyridine;2,2,2-trifluoroacetamide.
Molecular Properties
| Compound Name | 2-fluoro-6-methyl-4-(methylsulfanylmethyl)pyridine;2,2,2-trifluoroacetamide |
| PubChem CID | 144627184 |
| Molecular Formula | C10H12F4N2OS |
| Molecular Weight | 284.28 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | 2-fluoro-6-methyl-4-(methylsulfanylmethyl)pyridine;2,2,2-trifluoroacetamide |
| SMILES | CSCc1cc(C)nc(F)c1.NC(=O)C(F)(F)F |
| InChI | InChI=1S/C8H10FNS.C2H2F3NO/c1-6-3-7(5-11-2)4-8(9)10-6;3-2(4,5)1(6)7/h3-4H,5H2,1-2H3;(H2,6,7) |
| InChIKey | LOVXCNMCLYEQCJ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.28 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-6-methyl-4-(methylsulfanylmethyl)pyridine;2,2,2-trifluoroacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-6-methyl-4-(methylsulfanylmethyl)pyridine;2,2,2-trifluoroacetamide?
The IUPAC name of 2-fluoro-6-methyl-4-(methylsulfanylmethyl)pyridine;2,2,2-trifluoroacetamide (CID 144627184) is 2-fluoro-6-methyl-4-(methylsulfanylmethyl)pyridine;2,2,2-trifluoroacetamide.
What is the SMILES notation for 2-fluoro-6-methyl-4-(methylsulfanylmethyl)pyridine;2,2,2-trifluoroacetamide?
The canonical SMILES for 2-fluoro-6-methyl-4-(methylsulfanylmethyl)pyridine;2,2,2-trifluoroacetamide is CSCc1cc(C)nc(F)c1.NC(=O)C(F)(F)F.
What is the InChIKey of 2-fluoro-6-methyl-4-(methylsulfanylmethyl)pyridine;2,2,2-trifluoroacetamide?
The InChIKey is LOVXCNMCLYEQCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10FNS.C2H2F3NO/c1-6-3-7(5-11-2)4-8(9)10-6;3-2(4,5)1(6)7/h3-4H,5H2,1-2H3;(H2,6,7).
What are the key properties of 2-fluoro-6-methyl-4-(methylsulfanylmethyl)pyridine;2,2,2-trifluoroacetamide?
2-fluoro-6-methyl-4-(methylsulfanylmethyl)pyridine;2,2,2-trifluoroacetamide has a molecular weight of 284.28 g/mol, XLogP of 2.43, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-6-methyl-4-(methylsulfanylmethyl)pyridine;2,2,2-trifluoroacetamide is sourced from PubChem (CID 144627184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).