About ethyl 2-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-(4-methylphenyl)sulfonylacetate
ethyl 2-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-(4-methylphenyl)sulfonylacetate (PubChem CID 14462742) has the molecular formula C16H22O6S
and a molecular weight of 342.41 g/mol. Its IUPAC name is ethyl 2-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-(4-methylphenyl)sulfonylacetate.
Molecular Properties
| Compound Name | ethyl 2-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-(4-methylphenyl)sulfonylacetate |
| PubChem CID | 14462742 |
| Molecular Formula | C16H22O6S |
| Molecular Weight | 342.41 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | ethyl 2-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-(4-methylphenyl)sulfonylacetate |
| SMILES | CCOC(=O)C(C1COC(C)(C)O1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C16H22O6S/c1-5-20-15(17)14(13-10-21-16(3,4)22-13)23(18,19)12-8-6-11(2)7-9-12/h6-9,13-14H,5,10H2,1-4H3 |
| InChIKey | XKAJNOSQRDXSFN-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.41 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 2-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-(4-methylphenyl)sulfonylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-(4-methylphenyl)sulfonylacetate?
The IUPAC name of ethyl 2-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-(4-methylphenyl)sulfonylacetate (CID 14462742) is ethyl 2-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-(4-methylphenyl)sulfonylacetate.
What is the SMILES notation for ethyl 2-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-(4-methylphenyl)sulfonylacetate?
The canonical SMILES for ethyl 2-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-(4-methylphenyl)sulfonylacetate is CCOC(=O)C(C1COC(C)(C)O1)S(=O)(=O)c1ccc(C)cc1.
What is the InChIKey of ethyl 2-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-(4-methylphenyl)sulfonylacetate?
The InChIKey is XKAJNOSQRDXSFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22O6S/c1-5-20-15(17)14(13-10-21-16(3,4)22-13)23(18,19)12-8-6-11(2)7-9-12/h6-9,13-14H,5,10H2,1-4H3.
What are the key properties of ethyl 2-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-(4-methylphenyl)sulfonylacetate?
ethyl 2-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-(4-methylphenyl)sulfonylacetate has a molecular weight of 342.41 g/mol, XLogP of 1.85, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-(4-methylphenyl)sulfonylacetate is sourced from PubChem (CID 14462742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).