C27H33F6N7 — CID 144627435
2-[amino(methyl)amino]-1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-1-[[2-[butyl(ethyl)amino]quinolin-3-yl]methyl]guanidine (PubChem CID 144627435) has the molecular formula C27H33F6N7 and a molecular weight of 569.60 g/mol. Its IUPAC name is 2-[amino(methyl)amino]-1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-1-[[2-[butyl(ethyl)amino]quinolin-3-yl]methyl]guanidine.
| Compound Name | 2-[amino(methyl)amino]-1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-1-[[2-[butyl(ethyl)amino]quinolin-3-yl]methyl]guanidine |
|---|---|
| PubChem CID | 144627435 |
| Molecular Formula | C27H33F6N7 |
| Molecular Weight | 569.60 g/mol |
| Exact Mass | 569.27 |
| IUPAC Name | 2-[amino(methyl)amino]-1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-1-[[2-[butyl(ethyl)amino]quinolin-3-yl]methyl]guanidine |
| SMILES | CCCCN(CC)c1nc2ccccc2cc1CN(Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1)/C(N)=N/N(C)N |
| InChI | InChI=1S/C27H33F6N7/c1-4-6-11-39(5-2)24-20(14-19-9-7-8-10-23(19)36-24)17-40(25(34)37-38(3)35)16-18-12-21(26(28,29)30)15-22(13-18)27(31,32)33/h7-10,12-15H,4-6,11,16-17,35H2,1-3H3,(H2,34,37) |
| InChIKey | LOHUTSOQKSYQPB-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 87.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.60 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|