C11H15BCl2NO2 — CID 144627946
CID 144627946 (PubChem CID 144627946) has the molecular formula C11H15BCl2NO2 and a molecular weight of 274.96 g/mol.
| Compound Name | CID 144627946 |
|---|---|
| PubChem CID | 144627946 |
| Molecular Formula | C11H15BCl2NO2 |
| Molecular Weight | 274.96 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | — |
| SMILES | CC(C)(O)C(C)(C)O[B]c1cc(Cl)nc(Cl)c1 |
| InChI | InChI=1S/C11H15BCl2NO2/c1-10(2,16)11(3,4)17-12-7-5-8(13)15-9(14)6-7/h5-6,16H,1-4H3 |
| InChIKey | YPZABBHDAOGOTQ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.96 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|